C38H62N2O6 — CID 56988906
3-[2-[(1-nonylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 56988906) has the molecular formula C38H62N2O6 and a molecular weight of 642.92 g/mol. Its IUPAC name is 3-[2-[(1-nonylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[(1-nonylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 56988906 |
| Molecular Formula | C38H62N2O6 |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.46 |
| IUPAC Name | 3-[2-[(1-nonylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCCCCCCC1(C(=O)NC2CCCCC2C(CC(=O)O)c2[nH]ccc2C(=O)C2OC(C)(C)OCC2(C)C)CCCCC1 |
| InChI | InChI=1S/C38H62N2O6/c1-6-7-8-9-10-11-15-21-38(22-16-12-17-23-38)35(44)40-30-19-14-13-18-27(30)29(25-31(41)42)32-28(20-24-39-32)33(43)34-36(2,3)26-45-37(4,5)46-34/h20,24,27,29-30,34,39H,6-19,21-23,25-26H2,1-5H3,(H,40,44)(H,41,42) |
| InChIKey | AGDLNSVXLIBAAV-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|