C21H20N4O5 — CID 56988929
benzhydryl (2R,4S,6S,7S)-7-azido-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 56988929) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is benzhydryl (2R,4S,6S,7S)-7-azido-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | benzhydryl (2R,4S,6S,7S)-7-azido-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 56988929 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | benzhydryl (2R,4S,6S,7S)-7-azido-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CO[C@@H]1C[C@H]2[C@H](N=[N+]=[N-])C(=O)N2[C@@H](C(=O)OC(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C21H20N4O5/c1-28-16-12-15-17(23-24-22)19(26)25(15)20(29-16)21(27)30-18(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15-18,20H,12H2,1H3/t15-,16-,17-,20+/m0/s1 |
| InChIKey | UBLITPKFPLUPPI-OGNFBWPZSA-N |
| XLogP | 2.93 |
| TPSA | 113.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|