C11H13N5O5 — CID 56989041
1-(1,1-diisocyanatohexan-2-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 56989041) has the molecular formula C11H13N5O5 and a molecular weight of 295.26 g/mol. Its IUPAC name is 1-(1,1-diisocyanatohexan-2-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1,1-diisocyanatohexan-2-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 56989041 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-(1,1-diisocyanatohexan-2-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCC(C(N=C=O)N=C=O)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13N5O5/c1-2-3-4-7(8(12-5-17)13-6-18)16-10(20)14-9(19)15-11(16)21/h7-8H,2-4H2,1H3,(H2,14,15,19,20,21) |
| InChIKey | IDRXWZRUGQCMRI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|