C36H52O5SSi — CID 56989157
methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate (PubChem CID 56989157) has the molecular formula C36H52O5SSi and a molecular weight of 624.96 g/mol. Its IUPAC name is methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate.
| Compound Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
|---|---|
| PubChem CID | 56989157 |
| Molecular Formula | C36H52O5SSi |
| Molecular Weight | 624.96 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
| SMILES | COC(=O)CCCC#CC(O)C1C(=O)C(SCCCc2ccccc2)=CC1C=CC(O[Si](C)(C)C(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C36H52O5SSi/c1-36(2,3)43(5,6)41-31(28-19-13-14-20-28)24-23-29-26-32(42-25-15-18-27-16-9-7-10-17-27)35(39)34(29)30(37)21-11-8-12-22-33(38)40-4/h7,9-10,16-17,23-24,26,28-31,34,37H,8,12-15,18-20,22,25H2,1-6H3 |
| InChIKey | XBCLKIMVIBFQBR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.96 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|