C19H20FNO — CID 56989253
8-fluoro-2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one (PubChem CID 56989253) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 8-fluoro-2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one.
| Compound Name | 8-fluoro-2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one |
|---|---|
| PubChem CID | 56989253 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 8-fluoro-2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one |
| SMILES | CC1=CC(C)(C)N=C2CC3C(=O)c4cc(F)ccc4C3CC12 |
| InChI | InChI=1S/C19H20FNO/c1-10-9-19(2,3)21-17-8-16-14(7-13(10)17)12-5-4-11(20)6-15(12)18(16)22/h4-6,9,13-14,16H,7-8H2,1-3H3 |
| InChIKey | VSMBRTPCOFSHBE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|