About 3-aminopropyl 2-methylhex-2-enoate
3-aminopropyl 2-methylhex-2-enoate (PubChem CID 56989512) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-aminopropyl 2-methylhex-2-enoate.
Molecular Properties
| Compound Name | 3-aminopropyl 2-methylhex-2-enoate |
| PubChem CID | 56989512 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 3-aminopropyl 2-methylhex-2-enoate |
| SMILES | CCCC=C(C)C(=O)OCCCN |
| InChI | InChI=1S/C10H19NO2/c1-3-4-6-9(2)10(12)13-8-5-7-11/h6H,3-5,7-8,11H2,1-2H3 |
| InChIKey | LNFDYZZKCAESRT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl 2-methylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl 2-methylhex-2-enoate?
The IUPAC name of 3-aminopropyl 2-methylhex-2-enoate (CID 56989512) is 3-aminopropyl 2-methylhex-2-enoate.
What is the SMILES notation for 3-aminopropyl 2-methylhex-2-enoate?
The canonical SMILES for 3-aminopropyl 2-methylhex-2-enoate is CCCC=C(C)C(=O)OCCCN.
What is the InChIKey of 3-aminopropyl 2-methylhex-2-enoate?
The InChIKey is LNFDYZZKCAESRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-3-4-6-9(2)10(12)13-8-5-7-11/h6H,3-5,7-8,11H2,1-2H3.
What are the key properties of 3-aminopropyl 2-methylhex-2-enoate?
3-aminopropyl 2-methylhex-2-enoate has a molecular weight of 185.27 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl 2-methylhex-2-enoate is sourced from PubChem (CID 56989512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).