C32H46N2O2S — CID 56989967
4-tert-butyl-3-decoxy-N-[3-[(5-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]benzamide (PubChem CID 56989967) has the molecular formula C32H46N2O2S and a molecular weight of 522.80 g/mol. Its IUPAC name is 4-tert-butyl-3-decoxy-N-[3-[(5-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-3-decoxy-N-[3-[(5-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 56989967 |
| Molecular Formula | C32H46N2O2S |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 4-tert-butyl-3-decoxy-N-[3-[(5-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]benzamide |
| SMILES | CCCCCCCCCCOc1cc(C(=O)Nc2cccc(CN3C=C(C)SC3)c2)ccc1C(C)(C)C |
| InChI | InChI=1S/C32H46N2O2S/c1-6-7-8-9-10-11-12-13-19-36-30-21-27(17-18-29(30)32(3,4)5)31(35)33-28-16-14-15-26(20-28)23-34-22-25(2)37-24-34/h14-18,20-22H,6-13,19,23-24H2,1-5H3,(H,33,35) |
| InChIKey | CIXUCTDDEAGNQR-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|