C12H13ClF6N5OP — CID 56990062
7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-6-chloropurin-2-amine (PubChem CID 56990062) has the molecular formula C12H13ClF6N5OP and a molecular weight of 423.69 g/mol. Its IUPAC name is 7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-6-chloropurin-2-amine.
| Compound Name | 7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-6-chloropurin-2-amine |
|---|---|
| PubChem CID | 56990062 |
| Molecular Formula | C12H13ClF6N5OP |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-6-chloropurin-2-amine |
| SMILES | Nc1nc(Cl)c2c(ncn2CCOCP(CC(F)(F)F)CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H13ClF6N5OP/c13-8-7-9(23-10(20)22-8)21-5-24(7)1-2-25-6-26(3-11(14,15)16)4-12(17,18)19/h5H,1-4,6H2,(H2,20,22,23) |
| InChIKey | AIUVAVJPYJCSEP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|