About 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene
3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene (PubChem CID 56990392) has the molecular formula C12H15Cl
and a molecular weight of 194.71 g/mol. Its IUPAC name is 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene.
Analyze 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene?
The IUPAC name of 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene (CID 56990392) is 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene.
What is the SMILES notation for 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene?
The canonical SMILES for 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene is CC1=C2C=C(Cl)CCC2C(C)C=C1.
What is the InChIKey of 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene?
The InChIKey is WEBYQBFPMZGUBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl/c1-8-3-4-9(2)12-7-10(13)5-6-11(8)12/h3-4,7-8,11H,5-6H2,1-2H3.
What are the key properties of 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene?
3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene has a molecular weight of 194.71 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,8-dimethyl-1,2,8,8a-tetrahydronaphthalene is sourced from PubChem (CID 56990392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).