About fluoro pyridin-1-ium-1-yl trityl borate
fluoro pyridin-1-ium-1-yl trityl borate (PubChem CID 56990685) has the molecular formula C24H20BFNO3+
and a molecular weight of 400.24 g/mol. Its IUPAC name is fluoro pyridin-1-ium-1-yl trityl borate.
Molecular Properties
| Compound Name | fluoro pyridin-1-ium-1-yl trityl borate |
| PubChem CID | 56990685 |
| Molecular Formula | C24H20BFNO3+ |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | fluoro pyridin-1-ium-1-yl trityl borate |
| SMILES | FOB(O[n+]1ccccc1)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20BFNO3/c26-29-25(30-27-19-11-4-12-20-27)28-24(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-20H/q+1 |
| InChIKey | AJZNYPFXJZMLHD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze fluoro pyridin-1-ium-1-yl trityl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro pyridin-1-ium-1-yl trityl borate?
The IUPAC name of fluoro pyridin-1-ium-1-yl trityl borate (CID 56990685) is fluoro pyridin-1-ium-1-yl trityl borate.
What is the SMILES notation for fluoro pyridin-1-ium-1-yl trityl borate?
The canonical SMILES for fluoro pyridin-1-ium-1-yl trityl borate is FOB(O[n+]1ccccc1)OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of fluoro pyridin-1-ium-1-yl trityl borate?
The InChIKey is AJZNYPFXJZMLHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20BFNO3/c26-29-25(30-27-19-11-4-12-20-27)28-24(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-20H/q+1.
What are the key properties of fluoro pyridin-1-ium-1-yl trityl borate?
fluoro pyridin-1-ium-1-yl trityl borate has a molecular weight of 400.24 g/mol, XLogP of 4.30, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro pyridin-1-ium-1-yl trityl borate is sourced from PubChem (CID 56990685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).