C16H17F2N3O3S — CID 56991028
1,2,4-triazol-1-yl (2R,5R)-5-acetylsulfanyl-2-(2,4-difluorophenyl)hexanoate (PubChem CID 56991028) has the molecular formula C16H17F2N3O3S and a molecular weight of 369.39 g/mol. Its IUPAC name is 1,2,4-triazol-1-yl (2R,5R)-5-acetylsulfanyl-2-(2,4-difluorophenyl)hexanoate.
| Compound Name | 1,2,4-triazol-1-yl (2R,5R)-5-acetylsulfanyl-2-(2,4-difluorophenyl)hexanoate |
|---|---|
| PubChem CID | 56991028 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1,2,4-triazol-1-yl (2R,5R)-5-acetylsulfanyl-2-(2,4-difluorophenyl)hexanoate |
| SMILES | CC(=O)S[C@H](C)CC[C@@H](C(=O)On1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H17F2N3O3S/c1-10(25-11(2)22)3-5-14(13-6-4-12(17)7-15(13)18)16(23)24-21-9-19-8-20-21/h4,6-10,14H,3,5H2,1-2H3/t10-,14-/m1/s1 |
| InChIKey | PHGRQAZEWFVYHP-QMTHXVAHSA-N |
| XLogP | 2.74 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|