C10H18N4S2 — CID 56991116
6-[ethyl(3-methylbutyl)amino]-1H-1,3,5-triazine-2,4-dithione (PubChem CID 56991116) has the molecular formula C10H18N4S2 and a molecular weight of 258.42 g/mol. Its IUPAC name is 6-[ethyl(3-methylbutyl)amino]-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-[ethyl(3-methylbutyl)amino]-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 56991116 |
| Molecular Formula | C10H18N4S2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 6-[ethyl(3-methylbutyl)amino]-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCN(CCC(C)C)c1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C10H18N4S2/c1-4-14(6-5-7(2)3)8-11-9(15)13-10(16)12-8/h7H,4-6H2,1-3H3,(H2,11,12,13,15,16) |
| InChIKey | KZVKLNGTNIJKLH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|