C26H50N4O4 — CID 56991519
N-[6-[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)amino]hexyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)formamide (PubChem CID 56991519) has the molecular formula C26H50N4O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is N-[6-[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)amino]hexyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)formamide.
| Compound Name | N-[6-[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)amino]hexyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 56991519 |
| Molecular Formula | C26H50N4O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | N-[6-[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)amino]hexyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-3-yl)formamide |
| SMILES | CC1(C)CCC(N(C=O)CCCCCCN(C=O)C2CCC(C)(C)N(O)C2(C)C)C(C)(C)N1O |
| InChI | InChI=1S/C26H50N4O4/c1-23(2)15-13-21(25(5,6)29(23)33)27(19-31)17-11-9-10-12-18-28(20-32)22-14-16-24(3,4)30(34)26(22,7)8/h19-22,33-34H,9-18H2,1-8H3 |
| InChIKey | BIRKEPDETZHVTM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|