C22H37N — CID 56991544
2-cyclohexyl-11-pentyl-1-azacyclododeca-4,8,12-triene (PubChem CID 56991544) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is 2-cyclohexyl-11-pentyl-1-azacyclododeca-4,8,12-triene.
| Compound Name | 2-cyclohexyl-11-pentyl-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 56991544 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | 2-cyclohexyl-11-pentyl-1-azacyclododeca-4,8,12-triene |
| SMILES | CCCCCC1/C=N\C(C2CCCCC2)CC=CCCC=CC1 |
| InChI | InChI=1S/C22H37N/c1-2-3-9-14-20-15-10-6-4-5-7-13-18-22(23-19-20)21-16-11-8-12-17-21/h6-7,10,13,19-22H,2-5,8-9,11-12,14-18H2,1H3/b10-6?,13-7?,23-19- |
| InChIKey | JRGYZGRUEDVXTH-HSHKZNNISA-N |
| XLogP | 6.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|