C31H51N3O6 — CID 56991753
3-[2-(2-methylheptan-3-ylcarbamoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 56991753) has the molecular formula C31H51N3O6 and a molecular weight of 561.76 g/mol. Its IUPAC name is 3-[2-(2-methylheptan-3-ylcarbamoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-(2-methylheptan-3-ylcarbamoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 56991753 |
| Molecular Formula | C31H51N3O6 |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.38 |
| IUPAC Name | 3-[2-(2-methylheptan-3-ylcarbamoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCC(NC(=O)NC1CCCCC1C(CC(=O)O)c1[nH]ccc1C(=O)C1OC(C)(C)OCC1(C)C)C(C)C |
| InChI | InChI=1S/C31H51N3O6/c1-8-9-13-23(19(2)3)33-29(38)34-24-14-11-10-12-20(24)22(17-25(35)36)26-21(15-16-32-26)27(37)28-30(4,5)18-39-31(6,7)40-28/h15-16,19-20,22-24,28,32H,8-14,17-18H2,1-7H3,(H,35,36)(H2,33,34,38) |
| InChIKey | OVVVFRGLOTVTMS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |