C26H37NO4S — CID 56992083
7-[3-[2-(2,6-dimethylphenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid (PubChem CID 56992083) has the molecular formula C26H37NO4S and a molecular weight of 459.65 g/mol. Its IUPAC name is 7-[3-[2-(2,6-dimethylphenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid.
| Compound Name | 7-[3-[2-(2,6-dimethylphenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56992083 |
| Molecular Formula | C26H37NO4S |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 7-[3-[2-(2,6-dimethylphenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid |
| SMILES | Cc1cccc(C)c1CCS(=O)(=O)NC1=C(CC=CCCCC(=O)O)C2CC(C1)C2(C)C |
| InChI | InChI=1S/C26H37NO4S/c1-18-10-9-11-19(2)21(18)14-15-32(30,31)27-24-17-20-16-23(26(20,3)4)22(24)12-7-5-6-8-13-25(28)29/h5,7,9-11,20,23,27H,6,8,12-17H2,1-4H3,(H,28,29) |
| InChIKey | JIQJICANRQABBT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|