C14H20N2 — CID 56992397
7-piperidin-1-yl-6,7,8,8a-tetrahydroquinoline (PubChem CID 56992397) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 7-piperidin-1-yl-6,7,8,8a-tetrahydroquinoline.
| Compound Name | 7-piperidin-1-yl-6,7,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 56992397 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 7-piperidin-1-yl-6,7,8,8a-tetrahydroquinoline |
| SMILES | C1=CC2=CCC(N3CCCCC3)CC2N=C1 |
| InChI | InChI=1S/C14H20N2/c1-2-9-16(10-3-1)13-7-6-12-5-4-8-15-14(12)11-13/h4-6,8,13-14H,1-3,7,9-11H2 |
| InChIKey | QEFVECSKXAGXRA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |