C29H58N6 — CID 56992487
4-N,4-N,5,5-tetrakis(1-methylpiperidin-4-yl)pentane-1,4-diamine (PubChem CID 56992487) has the molecular formula C29H58N6 and a molecular weight of 490.83 g/mol. Its IUPAC name is 4-N,4-N,5,5-tetrakis(1-methylpiperidin-4-yl)pentane-1,4-diamine.
| Compound Name | 4-N,4-N,5,5-tetrakis(1-methylpiperidin-4-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 56992487 |
| Molecular Formula | C29H58N6 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.47 |
| IUPAC Name | 4-N,4-N,5,5-tetrakis(1-methylpiperidin-4-yl)pentane-1,4-diamine |
| SMILES | CN1CCC(C(C2CCN(C)CC2)C(CCCN)N(C2CCN(C)CC2)C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C29H58N6/c1-31-16-7-24(8-17-31)29(25-9-18-32(2)19-10-25)28(6-5-15-30)35(26-11-20-33(3)21-12-26)27-13-22-34(4)23-14-27/h24-29H,5-23,30H2,1-4H3 |
| InChIKey | SGRZEFUFPGYDFS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |