C20H18F2N6O — CID 56992565
(2S,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[4-(1,2,4-triazol-4-yl)phenyl]butan-2-ol (PubChem CID 56992565) has the molecular formula C20H18F2N6O and a molecular weight of 396.40 g/mol. Its IUPAC name is (2S,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[4-(1,2,4-triazol-4-yl)phenyl]butan-2-ol.
| Compound Name | (2S,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[4-(1,2,4-triazol-4-yl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 56992565 |
| Molecular Formula | C20H18F2N6O |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (2S,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[4-(1,2,4-triazol-4-yl)phenyl]butan-2-ol |
| SMILES | C[C@H](c1ccc(-n2cnnc2)cc1)[C@@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H18F2N6O/c1-14(15-2-5-17(6-3-15)27-12-24-25-13-27)20(29,9-28-11-23-10-26-28)18-7-4-16(21)8-19(18)22/h2-8,10-14,29H,9H2,1H3/t14-,20+/m1/s1 |
| InChIKey | DNIRAPPLJZSIEL-VLIAUNLRSA-N |
| XLogP | 2.83 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |