C12H22BNSi — CID 56992634
2-tert-butyl-1,1,3-trimethyl-3aH-cyclopenta[c][1,2,5]azasilaborole (PubChem CID 56992634) has the molecular formula C12H22BNSi and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-tert-butyl-1,1,3-trimethyl-3aH-cyclopenta[c][1,2,5]azasilaborole.
| Compound Name | 2-tert-butyl-1,1,3-trimethyl-3aH-cyclopenta[c][1,2,5]azasilaborole |
|---|---|
| PubChem CID | 56992634 |
| Molecular Formula | C12H22BNSi |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-tert-butyl-1,1,3-trimethyl-3aH-cyclopenta[c][1,2,5]azasilaborole |
| SMILES | CB1C2C=CC=C2[Si](C)(C)N1C(C)(C)C |
| InChI | InChI=1S/C12H22BNSi/c1-12(2,3)14-13(4)10-8-7-9-11(10)15(14,5)6/h7-10H,1-6H3 |
| InChIKey | LJDVVAWLEIYGGW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|