C19H14N6O — CID 56992782
2-amino-N-(4-naphthalen-1-yl-1,3,5-triazin-2-yl)pyridine-4-carboxamide (PubChem CID 56992782) has the molecular formula C19H14N6O and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-amino-N-(4-naphthalen-1-yl-1,3,5-triazin-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-amino-N-(4-naphthalen-1-yl-1,3,5-triazin-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56992782 |
| Molecular Formula | C19H14N6O |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-amino-N-(4-naphthalen-1-yl-1,3,5-triazin-2-yl)pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)Nc2ncnc(-c3cccc4ccccc34)n2)ccn1 |
| InChI | InChI=1S/C19H14N6O/c20-16-10-13(8-9-21-16)18(26)25-19-23-11-22-17(24-19)15-7-3-5-12-4-1-2-6-14(12)15/h1-11H,(H2,20,21)(H,22,23,24,25,26) |
| InChIKey | QEZPNHFYZHKMJC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |