C12H14O2 — CID 56993602
2-methoxy-4a,8,9,9a-tetrahydrobenzo[7]annulen-5-one (PubChem CID 56993602) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-methoxy-4a,8,9,9a-tetrahydrobenzo[7]annulen-5-one.
| Compound Name | 2-methoxy-4a,8,9,9a-tetrahydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 56993602 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-methoxy-4a,8,9,9a-tetrahydrobenzo[7]annulen-5-one |
| SMILES | COC1=CC2CCC=CC(=O)C2C=C1 |
| InChI | InChI=1S/C12H14O2/c1-14-10-6-7-11-9(8-10)4-2-3-5-12(11)13/h3,5-9,11H,2,4H2,1H3 |
| InChIKey | NEKJVCPSSBBJEL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |