About bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate
bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate (PubChem CID 56993673) has the molecular formula C20H28O8
and a molecular weight of 396.44 g/mol. Its IUPAC name is bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate |
| PubChem CID | 56993673 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CCCCC1C(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C20H28O8/c1-13(2)17(21)25-9-11-27-19(23)15-7-5-6-8-16(15)20(24)28-12-10-26-18(22)14(3)4/h15-16H,1,3,5-12H2,2,4H3 |
| InChIKey | KGZKKKOEQHJAKF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate?
The IUPAC name of bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate (CID 56993673) is bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate?
The canonical SMILES for bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate is C=C(C)C(=O)OCCOC(=O)C1CCCCC1C(=O)OCCOC(=O)C(=C)C.
What is the InChIKey of bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate?
The InChIKey is KGZKKKOEQHJAKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O8/c1-13(2)17(21)25-9-11-27-19(23)15-7-5-6-8-16(15)20(24)28-12-10-26-18(22)14(3)4/h15-16H,1,3,5-12H2,2,4H3.
What are the key properties of bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate?
bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate has a molecular weight of 396.44 g/mol, XLogP of 2.12, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 56993673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).