About [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone
[3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone (PubChem CID 56993676) has the molecular formula C21H20N2O6S
and a molecular weight of 428.47 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone |
| PubChem CID | 56993676 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(-c2scc3ccc([N+](=O)[O-])c(C(=O)N4CCOCC4)c23)cc1OC |
| InChI | InChI=1S/C21H20N2O6S/c1-27-16-6-4-13(11-17(16)28-2)20-18-14(12-30-20)3-5-15(23(25)26)19(18)21(24)22-7-9-29-10-8-22/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | LCCNEMWNXTWMDI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone?
The IUPAC name of [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone (CID 56993676) is [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone is COc1ccc(-c2scc3ccc([N+](=O)[O-])c(C(=O)N4CCOCC4)c23)cc1OC.
What is the InChIKey of [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone?
The InChIKey is LCCNEMWNXTWMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O6S/c1-27-16-6-4-13(11-17(16)28-2)20-18-14(12-30-20)3-5-15(23(25)26)19(18)21(24)22-7-9-29-10-8-22/h3-6,11-12H,7-10H2,1-2H3.
What are the key properties of [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone?
[3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone has a molecular weight of 428.47 g/mol, XLogP of 3.97, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dimethoxyphenyl)-5-nitro-2-benzothiophen-4-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 56993676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).