About 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate
2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate (PubChem CID 56994489) has the molecular formula C12H24O2S2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate.
Molecular Properties
| Compound Name | 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate |
| PubChem CID | 56994489 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate |
| SMILES | CCCCC(CC)CC(S)C(=O)OCCS |
| InChI | InChI=1S/C12H24O2S2/c1-3-5-6-10(4-2)9-11(16)12(13)14-7-8-15/h10-11,15-16H,3-9H2,1-2H3 |
| InChIKey | OZLPWKRCPSOZMA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate?
The IUPAC name of 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate (CID 56994489) is 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate.
What is the SMILES notation for 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate?
The canonical SMILES for 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate is CCCCC(CC)CC(S)C(=O)OCCS.
What is the InChIKey of 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate?
The InChIKey is OZLPWKRCPSOZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2S2/c1-3-5-6-10(4-2)9-11(16)12(13)14-7-8-15/h10-11,15-16H,3-9H2,1-2H3.
What are the key properties of 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate?
2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate has a molecular weight of 264.46 g/mol, XLogP of 3.36, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethyl 4-ethyl-2-sulfanyloctanoate is sourced from PubChem (CID 56994489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).