C25H40N2O2 — CID 56994560
(8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-7,10,13-trimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide (PubChem CID 56994560) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-7,10,13-trimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide.
| Compound Name | (8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-7,10,13-trimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 56994560 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | (8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-7,10,13-trimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide |
| SMILES | [H]/N=C1\C(=O)C(C(=O)NC(C)(C)C)C[C@@]2(C)C1CC(C)[C@@H]1[C@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C25H40N2O2/c1-14-12-18-20(26)21(28)15(22(29)27-23(2,3)4)13-25(18,6)17-9-11-24(5)10-7-8-16(24)19(14)17/h14-19,26H,7-13H2,1-6H3,(H,27,29)/b26-20-/t14?,15?,16-,17+,18?,19-,24-,25+/m0/s1 |
| InChIKey | UPFHEQDNOQXLLP-GZVKXLRASA-N |
| XLogP | 5.00 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|