About 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide
2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide (PubChem CID 569946) has the molecular formula C17H20N2O2S
and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide.
Molecular Properties
| Compound Name | 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide |
| PubChem CID | 569946 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2)c(C(=O)NC(C)C)c1C |
| InChI | InChI=1S/C17H20N2O2S/c1-10(2)18-16(21)14-11(3)12(4)22-17(14)19-15(20)13-8-6-5-7-9-13/h5-10H,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | XBSDXLHMNNTAKI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide?
The IUPAC name of 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide (CID 569946) is 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide.
What is the SMILES notation for 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide?
The canonical SMILES for 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide is Cc1sc(NC(=O)c2ccccc2)c(C(=O)NC(C)C)c1C.
What is the InChIKey of 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide?
The InChIKey is XBSDXLHMNNTAKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2S/c1-10(2)18-16(21)14-11(3)12(4)22-17(14)19-15(20)13-8-6-5-7-9-13/h5-10H,1-4H3,(H,18,21)(H,19,20).
What are the key properties of 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide?
2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide has a molecular weight of 316.43 g/mol, XLogP of 3.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-4,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide is sourced from PubChem (CID 569946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).