C22H37FO4 — CID 56994710
3a-[4-fluoro-4-methyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 56994710) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 3a-[4-fluoro-4-methyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | 3a-[4-fluoro-4-methyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 56994710 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 3a-[4-fluoro-4-methyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CC(F)(CC=CC12CCCC1(C)OC(O)C2)CCCCOC1CCCCO1 |
| InChI | InChI=1S/C22H37FO4/c1-20(23,10-4-6-16-26-19-9-3-5-15-25-19)11-7-13-22-14-8-12-21(22,2)27-18(24)17-22/h7,13,18-19,24H,3-6,8-12,14-17H2,1-2H3 |
| InChIKey | PDSREMWULIWNNX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|