About 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine
3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine (PubChem CID 56994718) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine |
| PubChem CID | 56994718 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine |
| SMILES | Cc1noc(NC(C)C)c1C |
| InChI | InChI=1S/C8H14N2O/c1-5(2)9-8-6(3)7(4)10-11-8/h5,9H,1-4H3 |
| InChIKey | YQMPCIUVJHQVRZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine?
The IUPAC name of 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine (CID 56994718) is 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine.
What is the SMILES notation for 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine?
The canonical SMILES for 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine is Cc1noc(NC(C)C)c1C.
What is the InChIKey of 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine?
The InChIKey is YQMPCIUVJHQVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-5(2)9-8-6(3)7(4)10-11-8/h5,9H,1-4H3.
What are the key properties of 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine?
3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine has a molecular weight of 154.21 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-N-propan-2-yl-1,2-oxazol-5-amine is sourced from PubChem (CID 56994718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).