C17H19NO — CID 56994850
(1Z)-N,N-dimethyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine (PubChem CID 56994850) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (1Z)-N,N-dimethyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine.
| Compound Name | (1Z)-N,N-dimethyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
|---|---|
| PubChem CID | 56994850 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (1Z)-N,N-dimethyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
| SMILES | CN(C)C1CC=c2cccc/c2=C2\C=CC=CC2O1 |
| InChI | InChI=1S/C17H19NO/c1-18(2)17-12-11-13-7-3-4-8-14(13)15-9-5-6-10-16(15)19-17/h3-11,16-17H,12H2,1-2H3/b13-11?,15-14- |
| InChIKey | UGEKHGQRWQDHDC-QSTOHMKHSA-N |
| XLogP | 1.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |