C23H32N2O4S — CID 56995329
1-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl-sulfinoamino]naphthalene (PubChem CID 56995329) has the molecular formula C23H32N2O4S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl-sulfinoamino]naphthalene.
| Compound Name | 1-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl-sulfinoamino]naphthalene |
|---|---|
| PubChem CID | 56995329 |
| Molecular Formula | C23H32N2O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl-sulfinoamino]naphthalene |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CN(c2cccc3ccccc23)S(=O)O)CC1 |
| InChI | InChI=1S/C23H32N2O4S/c1-23(2,3)29-22(26)24-15-17-11-13-18(14-12-17)16-25(30(27)28)21-10-6-8-19-7-4-5-9-20(19)21/h4-10,17-18H,11-16H2,1-3H3,(H,24,26)(H,27,28) |
| InChIKey | NWOJARLSYKWRCL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|