About (4Z)-3-chloro-4-fluorohexa-1,4-diene
(4Z)-3-chloro-4-fluorohexa-1,4-diene (PubChem CID 56996116) has the molecular formula C6H8ClF
and a molecular weight of 134.58 g/mol. Its IUPAC name is (4Z)-3-chloro-4-fluorohexa-1,4-diene.
Molecular Properties
| Compound Name | (4Z)-3-chloro-4-fluorohexa-1,4-diene |
| PubChem CID | 56996116 |
| Molecular Formula | C6H8ClF |
| Molecular Weight | 134.58 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | (4Z)-3-chloro-4-fluorohexa-1,4-diene |
| SMILES | C=CC(Cl)/C(F)=C/C |
| InChI | InChI=1S/C6H8ClF/c1-3-5(7)6(8)4-2/h3-5H,1H2,2H3/b6-4- |
| InChIKey | ZWLABNNQQMABBC-XQRVVYSFSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-3-chloro-4-fluorohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-3-chloro-4-fluorohexa-1,4-diene?
The IUPAC name of (4Z)-3-chloro-4-fluorohexa-1,4-diene (CID 56996116) is (4Z)-3-chloro-4-fluorohexa-1,4-diene.
What is the SMILES notation for (4Z)-3-chloro-4-fluorohexa-1,4-diene?
The canonical SMILES for (4Z)-3-chloro-4-fluorohexa-1,4-diene is C=CC(Cl)/C(F)=C/C.
What is the InChIKey of (4Z)-3-chloro-4-fluorohexa-1,4-diene?
The InChIKey is ZWLABNNQQMABBC-XQRVVYSFSA-N. The full InChI is InChI=1S/C6H8ClF/c1-3-5(7)6(8)4-2/h3-5H,1H2,2H3/b6-4-.
What are the key properties of (4Z)-3-chloro-4-fluorohexa-1,4-diene?
(4Z)-3-chloro-4-fluorohexa-1,4-diene has a molecular weight of 134.58 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3-chloro-4-fluorohexa-1,4-diene is sourced from PubChem (CID 56996116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).