C29H46O4S2 — CID 56996235
3-[[(9S,10R,13S,14S)-1-(2,3-dihydroxy-2-methylpropyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol (PubChem CID 56996235) has the molecular formula C29H46O4S2 and a molecular weight of 522.82 g/mol. Its IUPAC name is 3-[[(9S,10R,13S,14S)-1-(2,3-dihydroxy-2-methylpropyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol.
| Compound Name | 3-[[(9S,10R,13S,14S)-1-(2,3-dihydroxy-2-methylpropyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 56996235 |
| Molecular Formula | C29H46O4S2 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 3-[[(9S,10R,13S,14S)-1-(2,3-dihydroxy-2-methylpropyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol |
| SMILES | CCC1=CC[C@H]2C3=CC=C4CC(SCC(C)(O)CO)CC(SCC(C)(O)CO)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H46O4S2/c1-6-19-8-10-23-22-9-7-20-13-21(34-17-26(2,32)15-30)14-25(35-18-27(3,33)16-31)29(20,5)24(22)11-12-28(19,23)4/h7-9,21,23-25,30-33H,6,10-18H2,1-5H3/t21?,23-,24-,25?,26?,27?,28+,29-/m0/s1 |
| InChIKey | OCQDGRKAYCCTRV-FOOPJZSRSA-N |
| XLogP | 5.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|