About [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate
[1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate (PubChem CID 56996252) has the molecular formula C20H14F3N5O4S
and a molecular weight of 477.42 g/mol. Its IUPAC name is [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate.
Molecular Properties
| Compound Name | [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate |
| PubChem CID | 56996252 |
| Molecular Formula | C20H14F3N5O4S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate |
| SMILES | Cn1ncc(C(=O)c2ccc(-n3cncn3)cc2C(F)(F)F)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H14F3N5O4S/c1-27-19(32-33(30,31)14-5-3-2-4-6-14)16(10-25-27)18(29)15-8-7-13(28-12-24-11-26-28)9-17(15)20(21,22)23/h2-12H,1H3 |
| InChIKey | FFXFYRATXMMLEH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate?
The IUPAC name of [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate (CID 56996252) is [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate.
What is the SMILES notation for [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate?
The canonical SMILES for [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate is Cn1ncc(C(=O)c2ccc(-n3cncn3)cc2C(F)(F)F)c1OS(=O)(=O)c1ccccc1.
What is the InChIKey of [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate?
The InChIKey is FFXFYRATXMMLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N5O4S/c1-27-19(32-33(30,31)14-5-3-2-4-6-14)16(10-25-27)18(29)15-8-7-13(28-12-24-11-26-28)9-17(15)20(21,22)23/h2-12H,1H3.
What are the key properties of [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate?
[1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate has a molecular weight of 477.42 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate is sourced from PubChem (CID 56996252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).