C20H20N5O4S+ — CID 56996517
(2R,3S,4R,5R)-2-(4-anilino-5-thiophen-2-ylpyrazolo[5,1-f][1,2,4]triazin-7-ium-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 56996517) has the molecular formula C20H20N5O4S+ and a molecular weight of 426.48 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(4-anilino-5-thiophen-2-ylpyrazolo[5,1-f][1,2,4]triazin-7-ium-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(4-anilino-5-thiophen-2-ylpyrazolo[5,1-f][1,2,4]triazin-7-ium-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 56996517 |
| Molecular Formula | C20H20N5O4S+ |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-(4-anilino-5-thiophen-2-ylpyrazolo[5,1-f][1,2,4]triazin-7-ium-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H]([n+]2cc(-c3cccs3)c3c(Nc4ccccc4)ncnn32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20N5O4S/c26-10-14-17(27)18(28)20(29-14)24-9-13(15-7-4-8-30-15)16-19(21-11-22-25(16)24)23-12-5-2-1-3-6-12/h1-9,11,14,17-18,20,26-28H,10H2,(H,21,22,23)/q+1/t14-,17+,18+,20-/m1/s1 |
| InChIKey | TYHJQCKQZFECGT-QBMUGXQSSA-N |
| XLogP | 1.10 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|