C24H38F2O5 — CID 56997165
methyl 2-[1-fluoro-5-[(1S,2S,5S)-2-fluoro-5-hydroxy-2-octylcyclopentyl]-2-methylidenepent-3-enyl]-1,3-dioxolane-2-carboxylate (PubChem CID 56997165) has the molecular formula C24H38F2O5 and a molecular weight of 444.56 g/mol. Its IUPAC name is methyl 2-[1-fluoro-5-[(1S,2S,5S)-2-fluoro-5-hydroxy-2-octylcyclopentyl]-2-methylidenepent-3-enyl]-1,3-dioxolane-2-carboxylate.
| Compound Name | methyl 2-[1-fluoro-5-[(1S,2S,5S)-2-fluoro-5-hydroxy-2-octylcyclopentyl]-2-methylidenepent-3-enyl]-1,3-dioxolane-2-carboxylate |
|---|---|
| PubChem CID | 56997165 |
| Molecular Formula | C24H38F2O5 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | methyl 2-[1-fluoro-5-[(1S,2S,5S)-2-fluoro-5-hydroxy-2-octylcyclopentyl]-2-methylidenepent-3-enyl]-1,3-dioxolane-2-carboxylate |
| SMILES | C=C(C=CC[C@H]1[C@@H](O)CC[C@@]1(F)CCCCCCCC)C(F)C1(C(=O)OC)OCCO1 |
| InChI | InChI=1S/C24H38F2O5/c1-4-5-6-7-8-9-14-23(26)15-13-20(27)19(23)12-10-11-18(2)21(25)24(22(28)29-3)30-16-17-31-24/h10-11,19-21,27H,2,4-9,12-17H2,1,3H3/t19-,20-,21?,23-/m0/s1 |
| InChIKey | QINCFQQYNYPEAS-ZBUNJEDYSA-N |
| XLogP | 4.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|