C24H24Cl4F3NO3 — CID 56997387
N-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine (PubChem CID 56997387) has the molecular formula C24H24Cl4F3NO3 and a molecular weight of 573.27 g/mol. Its IUPAC name is N-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine.
| Compound Name | N-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine |
|---|---|
| PubChem CID | 56997387 |
| Molecular Formula | C24H24Cl4F3NO3 |
| Molecular Weight | 573.27 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | N-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine |
| SMILES | C=C(NOCCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24Cl4F3NO3/c1-16(17-6-8-18(9-7-17)24(29,30)31)32-35-12-5-3-2-4-11-34-23-20(25)14-19(15-21(23)26)33-13-10-22(27)28/h6-10,14-15,32H,1-5,11-13H2 |
| InChIKey | WJHWPGKJMYCLON-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.27 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|