C14H27N3O2 — CID 56997540
[(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)amino] N-tert-butylcarbamate (PubChem CID 56997540) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is [(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)amino] N-tert-butylcarbamate.
| Compound Name | [(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)amino] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 56997540 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | [(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)amino] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)ONC1=CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H27N3O2/c1-12(2,3)15-11(18)19-16-10-8-13(4,5)17-14(6,7)9-10/h8,16-17H,9H2,1-7H3,(H,15,18) |
| InChIKey | HELYQQGRLHOCAH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|