C20H23NO — CID 56997577
(3R,5R,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane (PubChem CID 56997577) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (3R,5R,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane.
| Compound Name | (3R,5R,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 56997577 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (3R,5R,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane |
| SMILES | c1ccc([C@@H]2CO[C@]3(CCCN[C@H]3c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H23NO/c1-3-8-16(9-4-1)18-14-20(22-15-18)12-7-13-21-19(20)17-10-5-2-6-11-17/h1-6,8-11,18-19,21H,7,12-15H2/t18-,19-,20+/m0/s1 |
| InChIKey | WJRYRJACQITXQC-SLFFLAALSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |