About 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde
2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde (PubChem CID 56997893) has the molecular formula C8H6N2O2S2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 56997893 |
| Molecular Formula | C8H6N2O2S2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2ncc(CO)s2)s1 |
| InChI | InChI=1S/C8H6N2O2S2/c11-3-5-1-9-7(13-5)8-10-2-6(4-12)14-8/h1-3,12H,4H2 |
| InChIKey | LSKVSLIQKGPRMS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde (CID 56997893) is 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde is O=Cc1cnc(-c2ncc(CO)s2)s1.
What is the InChIKey of 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde?
The InChIKey is LSKVSLIQKGPRMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S2/c11-3-5-1-9-7(13-5)8-10-2-6(4-12)14-8/h1-3,12H,4H2.
What are the key properties of 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde?
2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde has a molecular weight of 226.28 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(hydroxymethyl)-1,3-thiazol-2-yl]-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 56997893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).