C22H22F3NO3 — CID 56997981
2-[benzyl(methyl)amino]ethyl 3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate (PubChem CID 56997981) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]ethyl 3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate.
| Compound Name | 2-[benzyl(methyl)amino]ethyl 3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 56997981 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[benzyl(methyl)amino]ethyl 3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate |
| SMILES | CC(=O)C(=Cc1ccccc1C(F)(F)F)C(=O)OCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H22F3NO3/c1-16(27)19(14-18-10-6-7-11-20(18)22(23,24)25)21(28)29-13-12-26(2)15-17-8-4-3-5-9-17/h3-11,14H,12-13,15H2,1-2H3 |
| InChIKey | VTLBKFLHJZQVOR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|