C15H30O2Si2 — CID 56998113
trimethyl-[(4R,5S,6S)-5-methyl-6-trimethylsilyloxyoct-7-en-1-yn-4-yl]oxysilane (PubChem CID 56998113) has the molecular formula C15H30O2Si2 and a molecular weight of 298.58 g/mol. Its IUPAC name is trimethyl-[(4R,5S,6S)-5-methyl-6-trimethylsilyloxyoct-7-en-1-yn-4-yl]oxysilane.
| Compound Name | trimethyl-[(4R,5S,6S)-5-methyl-6-trimethylsilyloxyoct-7-en-1-yn-4-yl]oxysilane |
|---|---|
| PubChem CID | 56998113 |
| Molecular Formula | C15H30O2Si2 |
| Molecular Weight | 298.58 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | trimethyl-[(4R,5S,6S)-5-methyl-6-trimethylsilyloxyoct-7-en-1-yn-4-yl]oxysilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C)[C@H](C)[C@H](C=C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O2Si2/c1-10-12-15(17-19(7,8)9)13(3)14(11-2)16-18(4,5)6/h1,11,13-15H,2,12H2,3-9H3/t13-,14+,15-/m1/s1 |
| InChIKey | DHHRGRPPZWLBEF-QLFBSQMISA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|