About tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane
tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane (PubChem CID 56998132) has the molecular formula C15H24F2OSi
and a molecular weight of 286.44 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane |
| PubChem CID | 56998132 |
| Molecular Formula | C15H24F2OSi |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane |
| SMILES | Cc1ccccc1C(O[Si](C)(C)C(C)(C)C)C(F)F |
| InChI | InChI=1S/C15H24F2OSi/c1-11-9-7-8-10-12(11)13(14(16)17)18-19(5,6)15(2,3)4/h7-10,13-14H,1-6H3 |
| InChIKey | RQYCVDUVWQIUNQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane (CID 56998132) is tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane is Cc1ccccc1C(O[Si](C)(C)C(C)(C)C)C(F)F.
What is the InChIKey of tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane?
The InChIKey is RQYCVDUVWQIUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2OSi/c1-11-9-7-8-10-12(11)13(14(16)17)18-19(5,6)15(2,3)4/h7-10,13-14H,1-6H3.
What are the key properties of tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane?
tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane has a molecular weight of 286.44 g/mol, XLogP of 5.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2,2-difluoro-1-(2-methylphenyl)ethoxy]-dimethylsilane is sourced from PubChem (CID 56998132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).