C32H58F2O6Si — CID 56998241
methyl 7-[(1R,2R,3R,5S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 56998241) has the molecular formula C32H58F2O6Si and a molecular weight of 604.89 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 56998241 |
| Molecular Formula | C32H58F2O6Si |
| Molecular Weight | 604.89 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(CCC[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H58F2O6Si/c1-8-21-32(33,34)28(40-41(6,7)31(2,3)4)18-15-17-25-24(16-11-9-10-12-19-29(36)37-5)26(35)23-27(25)39-30-20-13-14-22-38-30/h9,11,24-28,30,35H,8,10,12-23H2,1-7H3/t24-,25-,26+,27-,28?,30?/m1/s1 |
| InChIKey | ZHKWTTYUZKMMEU-UJCRYAHBSA-N |
| XLogP | 8.18 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.89 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|