C20H25FNO5S+ — CID 56998351
(1S)-1-[(3S)-3-acetylsulfanyl-5-(3-fluorophenyl)-2-methyl-5-oxopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 56998351) has the molecular formula C20H25FNO5S+ and a molecular weight of 410.49 g/mol. Its IUPAC name is (1S)-1-[(3S)-3-acetylsulfanyl-5-(3-fluorophenyl)-2-methyl-5-oxopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S)-1-[(3S)-3-acetylsulfanyl-5-(3-fluorophenyl)-2-methyl-5-oxopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 56998351 |
| Molecular Formula | C20H25FNO5S+ |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (1S)-1-[(3S)-3-acetylsulfanyl-5-(3-fluorophenyl)-2-methyl-5-oxopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)S[C@@H](CC(=O)c1cccc(F)c1)C(C)C(=O)[N@+]1(C(=O)O)CCCC1C |
| InChI | InChI=1S/C20H24FNO5S/c1-12-6-5-9-22(12,20(26)27)19(25)13(2)18(28-14(3)23)11-17(24)15-7-4-8-16(21)10-15/h4,7-8,10,12-13,18H,5-6,9,11H2,1-3H3/p+1/t12?,13?,18-,22-/m0/s1 |
| InChIKey | SOWBWBRDXRGYHU-GMXFCSTGSA-O |
| XLogP | 3.89 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|