C9H14O2 — CID 56998353
2-methyl-3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran (PubChem CID 56998353) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-methyl-3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran.
| Compound Name | 2-methyl-3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 56998353 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-methyl-3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
| SMILES | C=C1C(C)OC2OCCCC12 |
| InChI | InChI=1S/C9H14O2/c1-6-7(2)11-9-8(6)4-3-5-10-9/h7-9H,1,3-5H2,2H3 |
| InChIKey | CBXDEXUVOCBRBU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|