About (2,2-difluorocyclopropyl) formate
(2,2-difluorocyclopropyl) formate (PubChem CID 56998384) has the molecular formula C4H4F2O2
and a molecular weight of 122.07 g/mol. Its IUPAC name is (2,2-difluorocyclopropyl) formate.
Molecular Properties
| Compound Name | (2,2-difluorocyclopropyl) formate |
| PubChem CID | 56998384 |
| Molecular Formula | C4H4F2O2 |
| Molecular Weight | 122.07 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | (2,2-difluorocyclopropyl) formate |
| SMILES | O=COC1CC1(F)F |
| InChI | InChI=1S/C4H4F2O2/c5-4(6)1-3(4)8-2-7/h2-3H,1H2 |
| InChIKey | KNPKFOCXMYBPBR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.07 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2,2-difluorocyclopropyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-difluorocyclopropyl) formate?
The IUPAC name of (2,2-difluorocyclopropyl) formate (CID 56998384) is (2,2-difluorocyclopropyl) formate.
What is the SMILES notation for (2,2-difluorocyclopropyl) formate?
The canonical SMILES for (2,2-difluorocyclopropyl) formate is O=COC1CC1(F)F.
What is the InChIKey of (2,2-difluorocyclopropyl) formate?
The InChIKey is KNPKFOCXMYBPBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F2O2/c5-4(6)1-3(4)8-2-7/h2-3H,1H2.
What are the key properties of (2,2-difluorocyclopropyl) formate?
(2,2-difluorocyclopropyl) formate has a molecular weight of 122.07 g/mol, XLogP of 0.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluorocyclopropyl) formate is sourced from PubChem (CID 56998384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).