C22H23F2NO — CID 56998488
1-(3,4-difluorophenyl)-8,8-dimethyl-2-(2-methylpyrrol-2-yl)non-4-en-6-yn-1-one (PubChem CID 56998488) has the molecular formula C22H23F2NO and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-8,8-dimethyl-2-(2-methylpyrrol-2-yl)non-4-en-6-yn-1-one.
| Compound Name | 1-(3,4-difluorophenyl)-8,8-dimethyl-2-(2-methylpyrrol-2-yl)non-4-en-6-yn-1-one |
|---|---|
| PubChem CID | 56998488 |
| Molecular Formula | C22H23F2NO |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-8,8-dimethyl-2-(2-methylpyrrol-2-yl)non-4-en-6-yn-1-one |
| SMILES | CC(C)(C)C#CC=CCC(C(=O)c1ccc(F)c(F)c1)C1(C)C=CC=N1 |
| InChI | InChI=1S/C22H23F2NO/c1-21(2,3)12-7-5-6-9-17(22(4)13-8-14-25-22)20(26)16-10-11-18(23)19(24)15-16/h5-6,8,10-11,13-15,17H,9H2,1-4H3 |
| InChIKey | KBHQNPIEVSPOFZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|