C24H34O3 — CID 56998683
3-[1-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid (PubChem CID 56998683) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 3-[1-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid.
| Compound Name | 3-[1-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid |
|---|---|
| PubChem CID | 56998683 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 3-[1-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid |
| SMILES | COC1(C(C)=CC(=O)O)CCC(c2ccc3c(c2)C(C)(C)CCC3(C)C)C1 |
| InChI | InChI=1S/C24H34O3/c1-16(13-21(25)26)24(27-6)10-9-18(15-24)17-7-8-19-20(14-17)23(4,5)12-11-22(19,2)3/h7-8,13-14,18H,9-12,15H2,1-6H3,(H,25,26) |
| InChIKey | GXRHQZBNIWEGPM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|