About 9-methoxypurine
9-methoxypurine (PubChem CID 56998918) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 9-methoxypurine.
Molecular Properties
| Compound Name | 9-methoxypurine |
| PubChem CID | 56998918 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 9-methoxypurine |
| SMILES | COn1cnc2cncnc21 |
| InChI | InChI=1S/C6H6N4O/c1-11-10-4-9-5-2-7-3-8-6(5)10/h2-4H,1H3 |
| InChIKey | SAXJNRGLVBCELX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-methoxypurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxypurine?
The IUPAC name of 9-methoxypurine (CID 56998918) is 9-methoxypurine.
What is the SMILES notation for 9-methoxypurine?
The canonical SMILES for 9-methoxypurine is COn1cnc2cncnc21.
What is the InChIKey of 9-methoxypurine?
The InChIKey is SAXJNRGLVBCELX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c1-11-10-4-9-5-2-7-3-8-6(5)10/h2-4H,1H3.
What are the key properties of 9-methoxypurine?
9-methoxypurine has a molecular weight of 150.14 g/mol, XLogP of -0.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxypurine is sourced from PubChem (CID 56998918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).